C20H16FN3O4 — CID 85013648
(5-fluoro-2-nitrophenyl) 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate (PubChem CID 85013648) has the molecular formula C20H16FN3O4 and a molecular weight of 381.36 g/mol. Its IUPAC name is (5-fluoro-2-nitrophenyl) 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate.
| Compound Name | (5-fluoro-2-nitrophenyl) 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 85013648 |
| Molecular Formula | C20H16FN3O4 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (5-fluoro-2-nitrophenyl) 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C=CC(=O)Oc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16FN3O4/c1-13-17(14(2)23(22-13)16-6-4-3-5-7-16)9-11-20(25)28-19-12-15(21)8-10-18(19)24(26)27/h3-12H,1-2H3 |
| InChIKey | IKRQRNBZOMGVCG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|