C20H17BrFN3O — CID 52653662
(E)-N-(2-bromo-4-fluorophenyl)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 52653662) has the molecular formula C20H17BrFN3O and a molecular weight of 414.28 g/mol. Its IUPAC name is (E)-N-(2-bromo-4-fluorophenyl)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-bromo-4-fluorophenyl)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 52653662 |
| Molecular Formula | C20H17BrFN3O |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | (E)-N-(2-bromo-4-fluorophenyl)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)Nc1ccc(F)cc1Br |
| InChI | InChI=1S/C20H17BrFN3O/c1-13-17(14(2)25(24-13)16-6-4-3-5-7-16)9-11-20(26)23-19-10-8-15(22)12-18(19)21/h3-12H,1-2H3,(H,23,26)/b11-9+ |
| InChIKey | JHMBOLYGGOOZPO-PKNBQFBNSA-N |
| XLogP | 5.04 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|