C23H23FN4O2S — CID 56579927
S-[2-[[(E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56579927) has the molecular formula C23H23FN4O2S and a molecular weight of 438.53 g/mol. Its IUPAC name is S-[2-[[(E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[2-[[(E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56579927 |
| Molecular Formula | C23H23FN4O2S |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | S-[2-[[(E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1/C=C/C(=O)Nc1ccccc1SC(=O)N(C)C |
| InChI | InChI=1S/C23H23FN4O2S/c1-15-19(16(2)28(26-15)18-11-9-17(24)10-12-18)13-14-22(29)25-20-7-5-6-8-21(20)31-23(30)27(3)4/h5-14H,1-4H3,(H,25,29)/b14-13+ |
| InChIKey | MBMVDQLGGVGMQQ-BUHFOSPRSA-N |
| XLogP | 5.05 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|