C23H24FN5O2 — CID 30486986
3-(dimethylamino)-N'-[(E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]benzohydrazide (PubChem CID 30486986) has the molecular formula C23H24FN5O2 and a molecular weight of 421.48 g/mol. Its IUPAC name is 3-(dimethylamino)-N'-[(E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]benzohydrazide.
| Compound Name | 3-(dimethylamino)-N'-[(E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 30486986 |
| Molecular Formula | C23H24FN5O2 |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 3-(dimethylamino)-N'-[(E)-3-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]prop-2-enoyl]benzohydrazide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1/C=C/C(=O)NNC(=O)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C23H24FN5O2/c1-15-21(16(2)29(27-15)19-10-8-18(24)9-11-19)12-13-22(30)25-26-23(31)17-6-5-7-20(14-17)28(3)4/h5-14H,1-4H3,(H,25,30)(H,26,31)/b13-12+ |
| InChIKey | QBHYVNZNCQASST-OUKQBFOZSA-N |
| XLogP | 3.17 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|