C24H26FN5O2 — CID 24616339
N'-[3-(dimethylamino)benzoyl]-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbohydrazide (PubChem CID 24616339) has the molecular formula C24H26FN5O2 and a molecular weight of 435.50 g/mol. Its IUPAC name is N'-[3-(dimethylamino)benzoyl]-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbohydrazide.
| Compound Name | N'-[3-(dimethylamino)benzoyl]-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 24616339 |
| Molecular Formula | C24H26FN5O2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | N'-[3-(dimethylamino)benzoyl]-1-(4-fluorophenyl)-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbohydrazide |
| SMILES | CN(C)c1cccc(C(=O)NNC(=O)c2nn(-c3ccc(F)cc3)c3c2CCCCC3)c1 |
| InChI | InChI=1S/C24H26FN5O2/c1-29(2)19-8-6-7-16(15-19)23(31)26-27-24(32)22-20-9-4-3-5-10-21(20)30(28-22)18-13-11-17(25)12-14-18/h6-8,11-15H,3-5,9-10H2,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | PUZFKWIRGDBZQW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|