C20H19ClFN5O2 — CID 27606125
5-chloro-N'-[3-(dimethylamino)benzoyl]-1-(4-fluorophenyl)-3-methylpyrazole-4-carbohydrazide (PubChem CID 27606125) has the molecular formula C20H19ClFN5O2 and a molecular weight of 415.86 g/mol. Its IUPAC name is 5-chloro-N'-[3-(dimethylamino)benzoyl]-1-(4-fluorophenyl)-3-methylpyrazole-4-carbohydrazide.
| Compound Name | 5-chloro-N'-[3-(dimethylamino)benzoyl]-1-(4-fluorophenyl)-3-methylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 27606125 |
| Molecular Formula | C20H19ClFN5O2 |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 5-chloro-N'-[3-(dimethylamino)benzoyl]-1-(4-fluorophenyl)-3-methylpyrazole-4-carbohydrazide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1C(=O)NNC(=O)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C20H19ClFN5O2/c1-12-17(18(21)27(25-12)15-9-7-14(22)8-10-15)20(29)24-23-19(28)13-5-4-6-16(11-13)26(2)3/h4-11H,1-3H3,(H,23,28)(H,24,29) |
| InChIKey | HMELRRWLUJPZAK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|