C16H13ClFN5O2 — CID 78813095
5-chloro-1-(4-fluorophenyl)-3-methyl-N'-(1H-pyrrole-2-carbonyl)pyrazole-4-carbohydrazide (PubChem CID 78813095) has the molecular formula C16H13ClFN5O2 and a molecular weight of 361.76 g/mol. Its IUPAC name is 5-chloro-1-(4-fluorophenyl)-3-methyl-N'-(1H-pyrrole-2-carbonyl)pyrazole-4-carbohydrazide.
| Compound Name | 5-chloro-1-(4-fluorophenyl)-3-methyl-N'-(1H-pyrrole-2-carbonyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 78813095 |
| Molecular Formula | C16H13ClFN5O2 |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 5-chloro-1-(4-fluorophenyl)-3-methyl-N'-(1H-pyrrole-2-carbonyl)pyrazole-4-carbohydrazide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1C(=O)NNC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C16H13ClFN5O2/c1-9-13(16(25)21-20-15(24)12-3-2-8-19-12)14(17)23(22-9)11-6-4-10(18)5-7-11/h2-8,19H,1H3,(H,20,24)(H,21,25) |
| InChIKey | UUZJHLWLPNFMMX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|