C18H14ClF2N3O — CID 9097679
5-chloro-N-(5-fluoro-2-methylphenyl)-1-(4-fluorophenyl)-3-methylpyrazole-4-carboxamide (PubChem CID 9097679) has the molecular formula C18H14ClF2N3O and a molecular weight of 361.78 g/mol. Its IUPAC name is 5-chloro-N-(5-fluoro-2-methylphenyl)-1-(4-fluorophenyl)-3-methylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-N-(5-fluoro-2-methylphenyl)-1-(4-fluorophenyl)-3-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 9097679 |
| Molecular Formula | C18H14ClF2N3O |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 5-chloro-N-(5-fluoro-2-methylphenyl)-1-(4-fluorophenyl)-3-methylpyrazole-4-carboxamide |
| SMILES | Cc1ccc(F)cc1NC(=O)c1c(C)nn(-c2ccc(F)cc2)c1Cl |
| InChI | InChI=1S/C18H14ClF2N3O/c1-10-3-4-13(21)9-15(10)22-18(25)16-11(2)23-24(17(16)19)14-7-5-12(20)6-8-14/h3-9H,1-2H3,(H,22,25) |
| InChIKey | XHNQLXLLHJBYCU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |