C23H25ClFN5O — CID 134016397
5-chloro-1-(4-fluorophenyl)-3-methyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]pyrazole-4-carboxamide (PubChem CID 134016397) has the molecular formula C23H25ClFN5O and a molecular weight of 441.94 g/mol. Its IUPAC name is 5-chloro-1-(4-fluorophenyl)-3-methyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-chloro-1-(4-fluorophenyl)-3-methyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134016397 |
| Molecular Formula | C23H25ClFN5O |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 5-chloro-1-(4-fluorophenyl)-3-methyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c(C)nn(-c3ccc(F)cc3)c2Cl)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C23H25ClFN5O/c1-15-14-18(6-9-20(15)29-12-10-28(3)11-13-29)26-23(31)21-16(2)27-30(22(21)24)19-7-4-17(25)5-8-19/h4-9,14H,10-13H2,1-3H3,(H,26,31) |
| InChIKey | OXNZXAWKGPDEEA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|