C17H22N4O2 — CID 39727257
5-methyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 39727257) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-methyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 39727257 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 5-methyl-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(N3CCN(C)CC3)c(C)c2)no1 |
| InChI | InChI=1S/C17H22N4O2/c1-12-10-14(18-17(22)15-11-13(2)23-19-15)4-5-16(12)21-8-6-20(3)7-9-21/h4-5,10-11H,6-9H2,1-3H3,(H,18,22) |
| InChIKey | YNJLGWPSZCYXJB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|