C24H28FN5O — CID 46671077
N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide (PubChem CID 46671077) has the molecular formula C24H28FN5O and a molecular weight of 421.52 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46671077 |
| Molecular Formula | C24H28FN5O |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3c(C)nn(-c4ccc(F)cc4)c3C)cc2)CC1 |
| InChI | InChI=1S/C24H28FN5O/c1-4-28-13-15-29(16-14-28)21-11-7-20(8-12-21)26-24(31)23-17(2)27-30(18(23)3)22-9-5-19(25)6-10-22/h5-12H,4,13-16H2,1-3H3,(H,26,31) |
| InChIKey | CLOXVOKSCVNWMW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|