C26H33N5O — CID 9329096
3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide (PubChem CID 9329096) has the molecular formula C26H33N5O and a molecular weight of 431.58 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide.
| Compound Name | 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 9329096 |
| Molecular Formula | C26H33N5O |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CCc3c(C)nn(-c4ccccc4)c3C)cc2)CC1 |
| InChI | InChI=1S/C26H33N5O/c1-4-29-16-18-30(19-17-29)23-12-10-22(11-13-23)27-26(32)15-14-25-20(2)28-31(21(25)3)24-8-6-5-7-9-24/h5-13H,4,14-19H2,1-3H3,(H,27,32) |
| InChIKey | RZAZROIWVKVFAL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|