C25H27FN6O2 — CID 22228069
N-[3-cyano-4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide (PubChem CID 22228069) has the molecular formula C25H27FN6O2 and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[3-cyano-4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide.
| Compound Name | N-[3-cyano-4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 22228069 |
| Molecular Formula | C25H27FN6O2 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-[3-cyano-4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]-1-(4-fluorophenyl)-3,5-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1C(=O)Nc1ccc(N2CCN(CCO)CC2)c(C#N)c1 |
| InChI | InChI=1S/C25H27FN6O2/c1-17-24(18(2)32(29-17)22-6-3-20(26)4-7-22)25(34)28-21-5-8-23(19(15-21)16-27)31-11-9-30(10-12-31)13-14-33/h3-8,15,33H,9-14H2,1-2H3,(H,28,34) |
| InChIKey | VONIRSJKQYMFJG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|