C28H31FN6O3 — CID 21018347
ethyl 4-[4-[2-cyano-4-[[1-(4-fluorophenyl)-5-methylpyrazole-4-carbonyl]amino]phenyl]piperazin-1-yl]butanoate (PubChem CID 21018347) has the molecular formula C28H31FN6O3 and a molecular weight of 518.59 g/mol. Its IUPAC name is ethyl 4-[4-[2-cyano-4-[[1-(4-fluorophenyl)-5-methylpyrazole-4-carbonyl]amino]phenyl]piperazin-1-yl]butanoate.
| Compound Name | ethyl 4-[4-[2-cyano-4-[[1-(4-fluorophenyl)-5-methylpyrazole-4-carbonyl]amino]phenyl]piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 21018347 |
| Molecular Formula | C28H31FN6O3 |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | ethyl 4-[4-[2-cyano-4-[[1-(4-fluorophenyl)-5-methylpyrazole-4-carbonyl]amino]phenyl]piperazin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCN1CCN(c2ccc(NC(=O)c3cnn(-c4ccc(F)cc4)c3C)cc2C#N)CC1 |
| InChI | InChI=1S/C28H31FN6O3/c1-3-38-27(36)5-4-12-33-13-15-34(16-14-33)26-11-8-23(17-21(26)18-30)32-28(37)25-19-31-35(20(25)2)24-9-6-22(29)7-10-24/h6-11,17,19H,3-5,12-16H2,1-2H3,(H,32,37) |
| InChIKey | ORFWXEHNJXAFHE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 103.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|