C23H24ClN5O3 — CID 22228136
1-(4-chlorophenyl)-N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]-5-methylpyrazole-4-carboxamide;hydrate (PubChem CID 22228136) has the molecular formula C23H24ClN5O3 and a molecular weight of 453.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]-5-methylpyrazole-4-carboxamide;hydrate.
| Compound Name | 1-(4-chlorophenyl)-N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]-5-methylpyrazole-4-carboxamide;hydrate |
|---|---|
| PubChem CID | 22228136 |
| Molecular Formula | C23H24ClN5O3 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[3-cyano-4-(4-hydroxypiperidin-1-yl)phenyl]-5-methylpyrazole-4-carboxamide;hydrate |
| SMILES | Cc1c(C(=O)Nc2ccc(N3CCC(O)CC3)c(C#N)c2)cnn1-c1ccc(Cl)cc1.O |
| InChI | InChI=1S/C23H22ClN5O2.H2O/c1-15-21(14-26-29(15)19-5-2-17(24)3-6-19)23(31)27-18-4-7-22(16(12-18)13-25)28-10-8-20(30)9-11-28;/h2-7,12,14,20,30H,8-11H2,1H3,(H,27,31);1H2 |
| InChIKey | VAUXBISMEZPSGA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|