C23H21ClN6O3 — CID 139946029
4-[4-[[1-(4-chlorophenyl)-5-methylpyrazole-4-carbonyl]amino]-2-cyanophenyl]piperazine-1-carboxylic acid (PubChem CID 139946029) has the molecular formula C23H21ClN6O3 and a molecular weight of 464.91 g/mol. Its IUPAC name is 4-[4-[[1-(4-chlorophenyl)-5-methylpyrazole-4-carbonyl]amino]-2-cyanophenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-[[1-(4-chlorophenyl)-5-methylpyrazole-4-carbonyl]amino]-2-cyanophenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 139946029 |
| Molecular Formula | C23H21ClN6O3 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 4-[4-[[1-(4-chlorophenyl)-5-methylpyrazole-4-carbonyl]amino]-2-cyanophenyl]piperazine-1-carboxylic acid |
| SMILES | Cc1c(C(=O)Nc2ccc(N3CCN(C(=O)O)CC3)c(C#N)c2)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H21ClN6O3/c1-15-20(14-26-30(15)19-5-2-17(24)3-6-19)22(31)27-18-4-7-21(16(12-18)13-25)28-8-10-29(11-9-28)23(32)33/h2-7,12,14H,8-11H2,1H3,(H,27,31)(H,32,33) |
| InChIKey | ULLUKBHTEQYWIU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|