C30H30ClN7O — CID 22227979
1-(4-chlorophenyl)-N-[3-cyano-4-[4-(3-pyridin-3-ylpropyl)piperazin-1-yl]phenyl]-5-methylpyrazole-4-carboxamide (PubChem CID 22227979) has the molecular formula C30H30ClN7O and a molecular weight of 540.07 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[3-cyano-4-[4-(3-pyridin-3-ylpropyl)piperazin-1-yl]phenyl]-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[3-cyano-4-[4-(3-pyridin-3-ylpropyl)piperazin-1-yl]phenyl]-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 22227979 |
| Molecular Formula | C30H30ClN7O |
| Molecular Weight | 540.07 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[3-cyano-4-[4-(3-pyridin-3-ylpropyl)piperazin-1-yl]phenyl]-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(N3CCN(CCCc4cccnc4)CC3)c(C#N)c2)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H30ClN7O/c1-22-28(21-34-38(22)27-9-6-25(31)7-10-27)30(39)35-26-8-11-29(24(18-26)19-32)37-16-14-36(15-17-37)13-3-5-23-4-2-12-33-20-23/h2,4,6-12,18,20-21H,3,5,13-17H2,1H3,(H,35,39) |
| InChIKey | UMPGINUKCWNDIT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.07 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|