C27H29ClN6O3 — CID 21018323
1-(4-chlorophenyl)-N-[3-cyano-4-[4-(4-oxidomorpholin-4-ium-4-yl)piperidin-1-yl]phenyl]-5-methylpyrazole-4-carboxamide (PubChem CID 21018323) has the molecular formula C27H29ClN6O3 and a molecular weight of 521.02 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[3-cyano-4-[4-(4-oxidomorpholin-4-ium-4-yl)piperidin-1-yl]phenyl]-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[3-cyano-4-[4-(4-oxidomorpholin-4-ium-4-yl)piperidin-1-yl]phenyl]-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 21018323 |
| Molecular Formula | C27H29ClN6O3 |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[3-cyano-4-[4-(4-oxidomorpholin-4-ium-4-yl)piperidin-1-yl]phenyl]-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(N3CCC([N+]4([O-])CCOCC4)CC3)c(C#N)c2)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H29ClN6O3/c1-19-25(18-30-33(19)23-5-2-21(28)3-6-23)27(35)31-22-4-7-26(20(16-22)17-29)32-10-8-24(9-11-32)34(36)12-14-37-15-13-34/h2-7,16,18,24H,8-15H2,1H3,(H,31,35) |
| InChIKey | RUEYAJMSAUZVHO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|