C29H35ClN6O3 — CID 22227914
N-[4-[4-[bis(2-methoxyethyl)amino]piperidin-1-yl]-3-cyanophenyl]-1-(4-chlorophenyl)-5-methylpyrazole-4-carboxamide (PubChem CID 22227914) has the molecular formula C29H35ClN6O3 and a molecular weight of 551.09 g/mol. Its IUPAC name is N-[4-[4-[bis(2-methoxyethyl)amino]piperidin-1-yl]-3-cyanophenyl]-1-(4-chlorophenyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | N-[4-[4-[bis(2-methoxyethyl)amino]piperidin-1-yl]-3-cyanophenyl]-1-(4-chlorophenyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 22227914 |
| Molecular Formula | C29H35ClN6O3 |
| Molecular Weight | 551.09 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | N-[4-[4-[bis(2-methoxyethyl)amino]piperidin-1-yl]-3-cyanophenyl]-1-(4-chlorophenyl)-5-methylpyrazole-4-carboxamide |
| SMILES | COCCN(CCOC)C1CCN(c2ccc(NC(=O)c3cnn(-c4ccc(Cl)cc4)c3C)cc2C#N)CC1 |
| InChI | InChI=1S/C29H35ClN6O3/c1-21-27(20-32-36(21)26-7-4-23(30)5-8-26)29(37)33-24-6-9-28(22(18-24)19-31)35-12-10-25(11-13-35)34(14-16-38-2)15-17-39-3/h4-9,18,20,25H,10-17H2,1-3H3,(H,33,37) |
| InChIKey | IATSCVDAYZBNGE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.09 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|