C25H28FN5O3 — CID 55380653
1-(4-fluorophenyl)-N,3,5-trimethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]pyrazole-4-carboxamide (PubChem CID 55380653) has the molecular formula C25H28FN5O3 and a molecular weight of 465.53 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N,3,5-trimethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]pyrazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N,3,5-trimethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55380653 |
| Molecular Formula | C25H28FN5O3 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-(4-fluorophenyl)-N,3,5-trimethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1C(=O)N(C)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H28FN5O3/c1-17-24(18(2)31(28-17)22-8-4-19(26)5-9-22)25(33)29(3)16-23(32)27-20-6-10-21(11-7-20)30-12-14-34-15-13-30/h4-11H,12-16H2,1-3H3,(H,27,32) |
| InChIKey | DOOPLTWDFMKEMN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|