C24H25FN4O4 — CID 55605925
3-(4-fluorophenyl)-N,5-dimethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1,2-oxazole-4-carboxamide (PubChem CID 55605925) has the molecular formula C24H25FN4O4 and a molecular weight of 452.49 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N,5-dimethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N,5-dimethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 55605925 |
| Molecular Formula | C24H25FN4O4 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 3-(4-fluorophenyl)-N,5-dimethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccc(F)cc2)c1C(=O)N(C)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H25FN4O4/c1-16-22(23(27-33-16)17-3-5-18(25)6-4-17)24(31)28(2)15-21(30)26-19-7-9-20(10-8-19)29-11-13-32-14-12-29/h3-10H,11-15H2,1-2H3,(H,26,30) |
| InChIKey | GEMVKINDQFKXPR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|