C18H14ClN5O4 — CID 29259929
5-chloro-3-methyl-N'-(3-nitrobenzoyl)-1-phenylpyrazole-4-carbohydrazide (PubChem CID 29259929) has the molecular formula C18H14ClN5O4 and a molecular weight of 399.79 g/mol. Its IUPAC name is 5-chloro-3-methyl-N'-(3-nitrobenzoyl)-1-phenylpyrazole-4-carbohydrazide.
| Compound Name | 5-chloro-3-methyl-N'-(3-nitrobenzoyl)-1-phenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 29259929 |
| Molecular Formula | C18H14ClN5O4 |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 5-chloro-3-methyl-N'-(3-nitrobenzoyl)-1-phenylpyrazole-4-carbohydrazide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C(=O)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14ClN5O4/c1-11-15(16(19)23(22-11)13-7-3-2-4-8-13)18(26)21-20-17(25)12-6-5-9-14(10-12)24(27)28/h2-10H,1H3,(H,20,25)(H,21,26) |
| InChIKey | OIXSMDLCXFMONN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|