C22H23N5O4 — CID 9140514
N-[2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 9140514) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is N-[2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 9140514 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-methylamino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN(C)C(=O)CNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H23N5O4/c1-15-20(16(2)26(24-15)18-9-5-4-6-10-18)14-25(3)21(28)13-23-22(29)17-8-7-11-19(12-17)27(30)31/h4-12H,13-14H2,1-3H3,(H,23,29) |
| InChIKey | WULZTHTYTIKJAV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|