C20H19ClN4O2 — CID 18225535
5-chloro-N'-(2,4-dimethylbenzoyl)-3-methyl-1-phenylpyrazole-4-carbohydrazide (PubChem CID 18225535) has the molecular formula C20H19ClN4O2 and a molecular weight of 382.85 g/mol. Its IUPAC name is 5-chloro-N'-(2,4-dimethylbenzoyl)-3-methyl-1-phenylpyrazole-4-carbohydrazide.
| Compound Name | 5-chloro-N'-(2,4-dimethylbenzoyl)-3-methyl-1-phenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 18225535 |
| Molecular Formula | C20H19ClN4O2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 5-chloro-N'-(2,4-dimethylbenzoyl)-3-methyl-1-phenylpyrazole-4-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2c(C)nn(-c3ccccc3)c2Cl)c(C)c1 |
| InChI | InChI=1S/C20H19ClN4O2/c1-12-9-10-16(13(2)11-12)19(26)22-23-20(27)17-14(3)24-25(18(17)21)15-7-5-4-6-8-15/h4-11H,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | QRKHINRPTCOGKI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|