C22H24N4O2S — CID 9276647
N'-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfanylacetyl]-2,4-dimethylbenzohydrazide (PubChem CID 9276647) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is N'-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfanylacetyl]-2,4-dimethylbenzohydrazide.
| Compound Name | N'-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfanylacetyl]-2,4-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 9276647 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N'-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)sulfanylacetyl]-2,4-dimethylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)CSc2c(C)nn(-c3ccccc3)c2C)c(C)c1 |
| InChI | InChI=1S/C22H24N4O2S/c1-14-10-11-19(15(2)12-14)22(28)24-23-20(27)13-29-21-16(3)25-26(17(21)4)18-8-6-5-7-9-18/h5-12H,13H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | JGGQVQNKXSDMPK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|