C20H23N3O3 — CID 9084877
N-[3-[2-(2,4-dimethylbenzoyl)hydrazinyl]-3-oxopropyl]-2-methylbenzamide (PubChem CID 9084877) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[3-[2-(2,4-dimethylbenzoyl)hydrazinyl]-3-oxopropyl]-2-methylbenzamide.
| Compound Name | N-[3-[2-(2,4-dimethylbenzoyl)hydrazinyl]-3-oxopropyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 9084877 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[3-[2-(2,4-dimethylbenzoyl)hydrazinyl]-3-oxopropyl]-2-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NNC(=O)CCNC(=O)c2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-13-8-9-17(15(3)12-13)20(26)23-22-18(24)10-11-21-19(25)16-7-5-4-6-14(16)2/h4-9,12H,10-11H2,1-3H3,(H,21,25)(H,22,24)(H,23,26) |
| InChIKey | DMKXSDTUJPNNPD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|