C21H21ClN4O5 — CID 4808544
5-chloro-3-methyl-1-phenyl-N'-(3,4,5-trimethoxybenzoyl)pyrazole-4-carbohydrazide (PubChem CID 4808544) has the molecular formula C21H21ClN4O5 and a molecular weight of 444.88 g/mol. Its IUPAC name is 5-chloro-3-methyl-1-phenyl-N'-(3,4,5-trimethoxybenzoyl)pyrazole-4-carbohydrazide.
| Compound Name | 5-chloro-3-methyl-1-phenyl-N'-(3,4,5-trimethoxybenzoyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 4808544 |
| Molecular Formula | C21H21ClN4O5 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 5-chloro-3-methyl-1-phenyl-N'-(3,4,5-trimethoxybenzoyl)pyrazole-4-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2c(C)nn(-c3ccccc3)c2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C21H21ClN4O5/c1-12-17(19(22)26(25-12)14-8-6-5-7-9-14)21(28)24-23-20(27)13-10-15(29-2)18(31-4)16(11-13)30-3/h5-11H,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | IFCYCCAEYUQQQL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|