C18H14N4O5 — CID 9033711
5-methyl-N'-(3-nitrobenzoyl)-3-phenyl-1,2-oxazole-4-carbohydrazide (PubChem CID 9033711) has the molecular formula C18H14N4O5 and a molecular weight of 366.33 g/mol. Its IUPAC name is 5-methyl-N'-(3-nitrobenzoyl)-3-phenyl-1,2-oxazole-4-carbohydrazide.
| Compound Name | 5-methyl-N'-(3-nitrobenzoyl)-3-phenyl-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9033711 |
| Molecular Formula | C18H14N4O5 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 5-methyl-N'-(3-nitrobenzoyl)-3-phenyl-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14N4O5/c1-11-15(16(21-27-11)12-6-3-2-4-7-12)18(24)20-19-17(23)13-8-5-9-14(10-13)22(25)26/h2-10H,1H3,(H,19,23)(H,20,24) |
| InChIKey | QNIWKPLXQKYYEP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|