C16H13BrN4O3 — CID 31597486
N'-(4-bromo-1H-pyrrole-2-carbonyl)-5-methyl-3-phenyl-1,2-oxazole-4-carbohydrazide (PubChem CID 31597486) has the molecular formula C16H13BrN4O3 and a molecular weight of 389.21 g/mol. Its IUPAC name is N'-(4-bromo-1H-pyrrole-2-carbonyl)-5-methyl-3-phenyl-1,2-oxazole-4-carbohydrazide.
| Compound Name | N'-(4-bromo-1H-pyrrole-2-carbonyl)-5-methyl-3-phenyl-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 31597486 |
| Molecular Formula | C16H13BrN4O3 |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | N'-(4-bromo-1H-pyrrole-2-carbonyl)-5-methyl-3-phenyl-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)NNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C16H13BrN4O3/c1-9-13(14(21-24-9)10-5-3-2-4-6-10)16(23)20-19-15(22)12-7-11(17)8-18-12/h2-8,18H,1H3,(H,19,22)(H,20,23) |
| InChIKey | NEYUSFNGAUKITJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|