C20H15N5O4 — CID 40672321
5-methyl-N'-(4-oxo-3H-phthalazine-1-carbonyl)-3-phenyl-1,2-oxazole-4-carbohydrazide (PubChem CID 40672321) has the molecular formula C20H15N5O4 and a molecular weight of 389.37 g/mol. Its IUPAC name is 5-methyl-N'-(4-oxo-3H-phthalazine-1-carbonyl)-3-phenyl-1,2-oxazole-4-carbohydrazide.
| Compound Name | 5-methyl-N'-(4-oxo-3H-phthalazine-1-carbonyl)-3-phenyl-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 40672321 |
| Molecular Formula | C20H15N5O4 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 5-methyl-N'-(4-oxo-3H-phthalazine-1-carbonyl)-3-phenyl-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)NNC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C20H15N5O4/c1-11-15(16(25-29-11)12-7-3-2-4-8-12)19(27)23-24-20(28)17-13-9-5-6-10-14(13)18(26)22-21-17/h2-10H,1H3,(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | HPVRTEGWTYDLSE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|