C22H16N4O3 — CID 27565264
4-oxo-N'-(2-phenylbenzoyl)-3H-phthalazine-1-carbohydrazide (PubChem CID 27565264) has the molecular formula C22H16N4O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is 4-oxo-N'-(2-phenylbenzoyl)-3H-phthalazine-1-carbohydrazide.
| Compound Name | 4-oxo-N'-(2-phenylbenzoyl)-3H-phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 27565264 |
| Molecular Formula | C22H16N4O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 4-oxo-N'-(2-phenylbenzoyl)-3H-phthalazine-1-carbohydrazide |
| SMILES | O=C(NNC(=O)c1n[nH]c(=O)c2ccccc12)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H16N4O3/c27-20(17-12-6-4-10-15(17)14-8-2-1-3-9-14)25-26-22(29)19-16-11-5-7-13-18(16)21(28)24-23-19/h1-13H,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | AHMWUQZXNCCCJE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|