C22H18N4O2 — CID 155501513
N-(5,6-dimethyl-4-phenyl-2-pyridinyl)-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 155501513) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-(5,6-dimethyl-4-phenyl-2-pyridinyl)-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-(5,6-dimethyl-4-phenyl-2-pyridinyl)-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 155501513 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-(5,6-dimethyl-4-phenyl-2-pyridinyl)-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | Cc1nc(NC(=O)c2n[nH]c(=O)c3ccccc23)cc(-c2ccccc2)c1C |
| InChI | InChI=1S/C22H18N4O2/c1-13-14(2)23-19(12-18(13)15-8-4-3-5-9-15)24-22(28)20-16-10-6-7-11-17(16)21(27)26-25-20/h3-12H,1-2H3,(H,26,27)(H,23,24,28) |
| InChIKey | XYDWCHFQOHVZPB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |