C15H7F5N4O2 — CID 17435460
4-oxo-N'-(2,3,4,5,6-pentafluorophenyl)-3H-phthalazine-1-carbohydrazide (PubChem CID 17435460) has the molecular formula C15H7F5N4O2 and a molecular weight of 370.24 g/mol. Its IUPAC name is 4-oxo-N'-(2,3,4,5,6-pentafluorophenyl)-3H-phthalazine-1-carbohydrazide.
| Compound Name | 4-oxo-N'-(2,3,4,5,6-pentafluorophenyl)-3H-phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 17435460 |
| Molecular Formula | C15H7F5N4O2 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 4-oxo-N'-(2,3,4,5,6-pentafluorophenyl)-3H-phthalazine-1-carbohydrazide |
| SMILES | O=C(NNc1c(F)c(F)c(F)c(F)c1F)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C15H7F5N4O2/c16-7-8(17)10(19)13(11(20)9(7)18)22-24-15(26)12-5-3-1-2-4-6(5)14(25)23-21-12/h1-4,22H,(H,23,25)(H,24,26) |
| InChIKey | HRMLOSIHEQZMCC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|