C13H13N3O5 — CID 107822736
(2R)-4-hydroxy-2-[(4-oxo-3H-phthalazine-1-carbonyl)amino]butanoic acid (PubChem CID 107822736) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-[(4-oxo-3H-phthalazine-1-carbonyl)amino]butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-[(4-oxo-3H-phthalazine-1-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 107822736 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (2R)-4-hydroxy-2-[(4-oxo-3H-phthalazine-1-carbonyl)amino]butanoic acid |
| SMILES | O=C(N[C@H](CCO)C(=O)O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C13H13N3O5/c17-6-5-9(13(20)21)14-12(19)10-7-3-1-2-4-8(7)11(18)16-15-10/h1-4,9,17H,5-6H2,(H,14,19)(H,16,18)(H,20,21)/t9-/m1/s1 |
| InChIKey | UMSSPQROJFLILN-SECBINFHSA-N |
| XLogP | -0.51 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |