C19H19N3O2 — CID 31355541
N-[(1S)-2-methyl-1-phenylpropyl]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 31355541) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[(1S)-2-methyl-1-phenylpropyl]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(1S)-2-methyl-1-phenylpropyl]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 31355541 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-[(1S)-2-methyl-1-phenylpropyl]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1n[nH]c(=O)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O2/c1-12(2)16(13-8-4-3-5-9-13)20-19(24)17-14-10-6-7-11-15(14)18(23)22-21-17/h3-12,16H,1-2H3,(H,20,24)(H,22,23)/t16-/m0/s1 |
| InChIKey | ZNZAMAWWKKMLCO-INIZCTEOSA-N |
| XLogP | 3.05 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |