C15H13N3O2S — CID 62843922
4-oxo-N-(1-thiophen-3-ylethyl)-3H-phthalazine-1-carboxamide (PubChem CID 62843922) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 4-oxo-N-(1-thiophen-3-ylethyl)-3H-phthalazine-1-carboxamide.
| Compound Name | 4-oxo-N-(1-thiophen-3-ylethyl)-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 62843922 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 4-oxo-N-(1-thiophen-3-ylethyl)-3H-phthalazine-1-carboxamide |
| SMILES | CC(NC(=O)c1n[nH]c(=O)c2ccccc12)c1ccsc1 |
| InChI | InChI=1S/C15H13N3O2S/c1-9(10-6-7-21-8-10)16-15(20)13-11-4-2-3-5-12(11)14(19)18-17-13/h2-9H,1H3,(H,16,20)(H,18,19) |
| InChIKey | XQKJFKLUTNETBJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |