C18H16N4O3S — CID 27565418
4-oxo-N'-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)-3H-phthalazine-1-carbohydrazide (PubChem CID 27565418) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is 4-oxo-N'-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)-3H-phthalazine-1-carbohydrazide.
| Compound Name | 4-oxo-N'-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)-3H-phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 27565418 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-oxo-N'-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)-3H-phthalazine-1-carbohydrazide |
| SMILES | O=C(NNC(=O)c1n[nH]c(=O)c2ccccc12)c1csc2c1CCCC2 |
| InChI | InChI=1S/C18H16N4O3S/c23-16-12-7-2-1-6-11(12)15(19-20-16)18(25)22-21-17(24)13-9-26-14-8-4-3-5-10(13)14/h1-2,6-7,9H,3-5,8H2,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | WLAQIFOCMKRIDE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|