C20H19N3O3 — CID 154840495
N-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 154840495) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 154840495 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-[(2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)methyl]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | O=C(NCc1c(O)ccc2c1CCCC2)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C20H19N3O3/c24-17-10-9-12-5-1-2-6-13(12)16(17)11-21-20(26)18-14-7-3-4-8-15(14)19(25)23-22-18/h3-4,7-10,24H,1-2,5-6,11H2,(H,21,26)(H,23,25) |
| InChIKey | DMWMQLBDCJTJGQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|