C27H20N6O3 — CID 26873731
N'-[(E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]-4-oxo-3H-phthalazine-1-carbohydrazide (PubChem CID 26873731) has the molecular formula C27H20N6O3 and a molecular weight of 476.50 g/mol. Its IUPAC name is N'-[(E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]-4-oxo-3H-phthalazine-1-carbohydrazide.
| Compound Name | N'-[(E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]-4-oxo-3H-phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 26873731 |
| Molecular Formula | C27H20N6O3 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N'-[(E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]-4-oxo-3H-phthalazine-1-carbohydrazide |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1ccccc1)NNC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C27H20N6O3/c34-23(28-31-27(36)25-21-13-7-8-14-22(21)26(35)30-29-25)16-15-19-17-33(20-11-5-2-6-12-20)32-24(19)18-9-3-1-4-10-18/h1-17H,(H,28,34)(H,30,35)(H,31,36)/b16-15+ |
| InChIKey | DOGCKFUXCUTHNR-FOCLMDBBSA-N |
| XLogP | 3.25 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|