C27H23FN4O4 — CID 55334060
N'-[(E)-3-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoyl]-4-fluorobenzohydrazide (PubChem CID 55334060) has the molecular formula C27H23FN4O4 and a molecular weight of 486.50 g/mol. Its IUPAC name is N'-[(E)-3-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[(E)-3-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 55334060 |
| Molecular Formula | C27H23FN4O4 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | N'-[(E)-3-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoyl]-4-fluorobenzohydrazide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=C/C(=O)NNC(=O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C27H23FN4O4/c1-35-23-14-10-19(16-24(23)36-2)26-20(17-32(31-26)22-6-4-3-5-7-22)11-15-25(33)29-30-27(34)18-8-12-21(28)13-9-18/h3-17H,1-2H3,(H,29,33)(H,30,34)/b15-11+ |
| InChIKey | UKCPWBTYJHXWEZ-RVDMUPIBSA-N |
| XLogP | 4.17 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|