C26H20N4O4 — CID 4782873
N'-[3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 4782873) has the molecular formula C26H20N4O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is N'-[3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 4782873 |
| Molecular Formula | C26H20N4O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N'-[3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(C=Cc1cn(-c2ccccc2)nc1-c1ccccc1)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H20N4O4/c31-24(27-28-26(32)19-11-13-22-23(15-19)34-17-33-22)14-12-20-16-30(21-9-5-2-6-10-21)29-25(20)18-7-3-1-4-8-18/h1-16H,17H2,(H,27,31)(H,28,32) |
| InChIKey | PCLZBUXXPYDGJP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|