C26H20N2O4 — CID 6235927
(E)-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-1-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 6235927) has the molecular formula C26H20N2O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is (E)-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-1-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6235927 |
| Molecular Formula | C26H20N2O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (E)-3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1ccc2c(c1)OCCO2)c1ccc(O)cc1 |
| InChI | InChI=1S/C26H20N2O4/c29-22-10-6-18(7-11-22)23(30)12-8-20-17-28(21-4-2-1-3-5-21)27-26(20)19-9-13-24-25(16-19)32-15-14-31-24/h1-13,16-17,29H,14-15H2/b12-8+ |
| InChIKey | CBHPJBWKGKUYPH-XYOKQWHBSA-N |
| XLogP | 4.91 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|