C27H21FN2O4 — CID 4995424
3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one (PubChem CID 4995424) has the molecular formula C27H21FN2O4 and a molecular weight of 456.47 g/mol. Its IUPAC name is 3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4995424 |
| Molecular Formula | C27H21FN2O4 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]-1-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=Cc2cn(-c3ccccc3)nc2-c2ccc3c(c2)OCCO3)c(F)c1 |
| InChI | InChI=1S/C27H21FN2O4/c1-32-21-9-10-22(23(28)16-21)24(31)11-7-19-17-30(20-5-3-2-4-6-20)29-27(19)18-8-12-25-26(15-18)34-14-13-33-25/h2-12,15-17H,13-14H2,1H3 |
| InChIKey | ONOXTJISJZOAEM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|