C18H14N4O5 — CID 17419223
N'-(1,3-benzodioxole-5-carbonyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide (PubChem CID 17419223) has the molecular formula C18H14N4O5 and a molecular weight of 366.33 g/mol. Its IUPAC name is N'-(1,3-benzodioxole-5-carbonyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide.
| Compound Name | N'-(1,3-benzodioxole-5-carbonyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 17419223 |
| Molecular Formula | C18H14N4O5 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N'-(1,3-benzodioxole-5-carbonyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1nn(-c2ccccc2)cc1O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H14N4O5/c23-13-9-22(12-4-2-1-3-5-12)21-16(13)18(25)20-19-17(24)11-6-7-14-15(8-11)27-10-26-14/h1-9,23H,10H2,(H,19,24)(H,20,25) |
| InChIKey | KHLJAXJHAJNBSE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|