C21H20N4O3S2 — CID 46657592
N'-[4-(1,3-dithian-2-yl)benzoyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide (PubChem CID 46657592) has the molecular formula C21H20N4O3S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is N'-[4-(1,3-dithian-2-yl)benzoyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide.
| Compound Name | N'-[4-(1,3-dithian-2-yl)benzoyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 46657592 |
| Molecular Formula | C21H20N4O3S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N'-[4-(1,3-dithian-2-yl)benzoyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1nn(-c2ccccc2)cc1O)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C21H20N4O3S2/c26-17-13-25(16-5-2-1-3-6-16)24-18(17)20(28)23-22-19(27)14-7-9-15(10-8-14)21-29-11-4-12-30-21/h1-3,5-10,13,21,26H,4,11-12H2,(H,22,27)(H,23,28) |
| InChIKey | ZXEJMGHKZDUSRE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|