C17H18N4O3 — CID 51276609
N'-(cyclohex-3-ene-1-carbonyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide (PubChem CID 51276609) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is N'-(cyclohex-3-ene-1-carbonyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide.
| Compound Name | N'-(cyclohex-3-ene-1-carbonyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 51276609 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N'-(cyclohex-3-ene-1-carbonyl)-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CC=CCC1)c1nn(-c2ccccc2)cc1O |
| InChI | InChI=1S/C17H18N4O3/c22-14-11-21(13-9-5-2-6-10-13)20-15(14)17(24)19-18-16(23)12-7-3-1-4-8-12/h1-3,5-6,9-12,22H,4,7-8H2,(H,18,23)(H,19,24) |
| InChIKey | DUTWMQHISRVVBM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|