C15H18N4O3 — CID 17478623
4-hydroxy-N'-pentanoyl-1-phenylpyrazole-3-carbohydrazide (PubChem CID 17478623) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-hydroxy-N'-pentanoyl-1-phenylpyrazole-3-carbohydrazide.
| Compound Name | 4-hydroxy-N'-pentanoyl-1-phenylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 17478623 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-hydroxy-N'-pentanoyl-1-phenylpyrazole-3-carbohydrazide |
| SMILES | CCCCC(=O)NNC(=O)c1nn(-c2ccccc2)cc1O |
| InChI | InChI=1S/C15H18N4O3/c1-2-3-9-13(21)16-17-15(22)14-12(20)10-19(18-14)11-7-5-4-6-8-11/h4-8,10,20H,2-3,9H2,1H3,(H,16,21)(H,17,22) |
| InChIKey | WTMLYWYVHUYGSN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|