C23H24N4O6 — CID 46491466
N'-[4-(4-acetyl-2-methoxyphenoxy)butanoyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide (PubChem CID 46491466) has the molecular formula C23H24N4O6 and a molecular weight of 452.47 g/mol. Its IUPAC name is N'-[4-(4-acetyl-2-methoxyphenoxy)butanoyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide.
| Compound Name | N'-[4-(4-acetyl-2-methoxyphenoxy)butanoyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 46491466 |
| Molecular Formula | C23H24N4O6 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N'-[4-(4-acetyl-2-methoxyphenoxy)butanoyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)NNC(=O)c1nn(-c2ccccc2)cc1O |
| InChI | InChI=1S/C23H24N4O6/c1-15(28)16-10-11-19(20(13-16)32-2)33-12-6-9-21(30)24-25-23(31)22-18(29)14-27(26-22)17-7-4-3-5-8-17/h3-5,7-8,10-11,13-14,29H,6,9,12H2,1-2H3,(H,24,30)(H,25,31) |
| InChIKey | JUGLVOFLXJWLPM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|