C20H18N4O4 — CID 46578325
4-hydroxy-1-phenyl-N'-(4-prop-2-enoxybenzoyl)pyrazole-3-carbohydrazide (PubChem CID 46578325) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is 4-hydroxy-1-phenyl-N'-(4-prop-2-enoxybenzoyl)pyrazole-3-carbohydrazide.
| Compound Name | 4-hydroxy-1-phenyl-N'-(4-prop-2-enoxybenzoyl)pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 46578325 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 4-hydroxy-1-phenyl-N'-(4-prop-2-enoxybenzoyl)pyrazole-3-carbohydrazide |
| SMILES | C=CCOc1ccc(C(=O)NNC(=O)c2nn(-c3ccccc3)cc2O)cc1 |
| InChI | InChI=1S/C20H18N4O4/c1-2-12-28-16-10-8-14(9-11-16)19(26)21-22-20(27)18-17(25)13-24(23-18)15-6-4-3-5-7-15/h2-11,13,25H,1,12H2,(H,21,26)(H,22,27) |
| InChIKey | BTYRZVIKASRUEW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|