C18H15ClN4O3 — CID 17483063
N'-[2-(4-chlorophenyl)acetyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide (PubChem CID 17483063) has the molecular formula C18H15ClN4O3 and a molecular weight of 370.80 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)acetyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)acetyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 17483063 |
| Molecular Formula | C18H15ClN4O3 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N'-[2-(4-chlorophenyl)acetyl]-4-hydroxy-1-phenylpyrazole-3-carbohydrazide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NNC(=O)c1nn(-c2ccccc2)cc1O |
| InChI | InChI=1S/C18H15ClN4O3/c19-13-8-6-12(7-9-13)10-16(25)20-21-18(26)17-15(24)11-23(22-17)14-4-2-1-3-5-14/h1-9,11,24H,10H2,(H,20,25)(H,21,26) |
| InChIKey | XZBGZJKXCFVEHF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|